Products 863886-05-9
CAS 863886-05-9 appears in our catalog under these names: Methyl 3,4-diamino-5-chlorobenzoate, 97%, Methyl 3,4-diamino-5-chlorobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 2,5g, 250mg.
Methyl 3,4-diamino-5-chlorobenzoate (CAS 863886-05-9) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 3,4-diamino-5-chlorobenzoate. InChIKey: SSLPIFFJNSMGLT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 3,4-diamino-5-chlorobenzoate |
| InChIKey | SSLPIFFJNSMGLT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Cl)N)N |
Computed by PubChem (NCBI)