CAS 864178-66-5 is the registry number for 4-Chloro-3-methylbenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-methylbenzohydrazide (CAS 864178-66-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 4-chloro-3-methylbenzohydrazide. InChIKey: KHEWUFRISVRYAX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 4-chloro-3-methylbenzohydrazide |
| InChIKey | KHEWUFRISVRYAX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NN)Cl |
Computed by PubChem (NCBI)