CAS 864185-81-9 is the registry number for octahydro-,ethylester,(1S,3aR,6aS)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate (CAS 864185-81-9) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: ethyl (3R,3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate. InChIKey: BFZUEHILBXRWGT-IWSPIJDZSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | ethyl (3R,3aR,6aS)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylate |
| InChIKey | BFZUEHILBXRWGT-IWSPIJDZSA-N |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CCC[C@@H]2CN1 |
Computed by PubChem (NCBI)