Products 864933-71-1
CAS 864933-71-1 is the registry number for ONPG-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)(613C)oxane-3,4,5-triol (CAS 864933-71-1) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 302.24 g/mol. IUPAC name: (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)(613C)oxane-3,4,5-triol. InChIKey: KUWPCJHYPSUOFW-AHIYVFTMSA-N.
| Molecular formula | C12H15NO8 |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)(613C)oxane-3,4,5-triol |
| InChIKey | KUWPCJHYPSUOFW-AHIYVFTMSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])O[13C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)