CAS 2816-24-2 appears in our catalog under these names: 2-Nitrophenyl b-D-glucopyranoside, 2-Nitrophenyl β-D-glucopyranoside, 2-Nitrophenyl-beta-d-glucopyranoside, 95%, 2-Nitrophenyl b-D-glucopyranoside, 99.00%, 2-Nitrophenyl Β-D-Glucopyranoside, ≥99%, ≥99%. Offered by: Biosynth, MedChemExpress, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 25g, 50g, 100g, 250 mg, 50 mg, 100 mg.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol (CAS 2816-24-2) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol. InChIKey: KUWPCJHYPSUOFW-RMPHRYRLSA-N.
| Molecular formula | C12H15NO8 |
|---|---|
| Molecular weight | 301.25 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | KUWPCJHYPSUOFW-RMPHRYRLSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)