CAS 19710-96-4 is the registry number for (2R,3R,4S,5R)-2-(Hydroxymethyl)-6-(2-nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4S,5R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol (CAS 19710-96-4) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol. InChIKey: KUWPCJHYPSUOFW-SCWFEDMQSA-N.
| Molecular formula | C12H15NO8 |
|---|---|
| Molecular weight | 301.25 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | KUWPCJHYPSUOFW-SCWFEDMQSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)