CAS 56193-44-3 appears in our catalog under these names: 2-Nitrophenyl α-D-glucopyranoside, 2-Nitrophenyl α-D-glucopyranoside, 2-Nitrophenyl a-D-glucopyranoside. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 1g, 250mg, 500mg, 1000mg, Get quote.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol (CAS 56193-44-3) is a chemical compound with the molecular formula C12H15NO8 and a molecular weight of 301.25 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol. InChIKey: KUWPCJHYPSUOFW-ZIQFBCGOSA-N.
| Molecular formula | C12H15NO8 |
|---|---|
| Molecular weight | 301.25 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(2-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | KUWPCJHYPSUOFW-ZIQFBCGOSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)