CAS 865837-16-7 is the registry number for N-(5-Amino-2-fluorophenyl)-2-phenylacetamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
N-(5-amino-2-fluorophenyl)-2-phenylacetamide (CAS 865837-16-7) is a chemical compound with the molecular formula C14H13FN2O and a molecular weight of 244.26 g/mol. IUPAC name: N-(5-amino-2-fluorophenyl)-2-phenylacetamide. InChIKey: BXQBKPYNSGAUHV-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | N-(5-amino-2-fluorophenyl)-2-phenylacetamide |
| InChIKey | BXQBKPYNSGAUHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=C(C=CC(=C2)N)F |
Computed by PubChem (NCBI)