CAS 86615-96-5 is the registry number for BRL 35135. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetate (CAS 86615-96-5) is a chemical compound with the molecular formula C20H24ClNO4 and a molecular weight of 377.9 g/mol. IUPAC name: methyl 2-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetate. InChIKey: ZFLBZHXQAMUEFS-PKDNWHCCSA-N.
| Molecular formula | C20H24ClNO4 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | methyl 2-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]acetate |
| InChIKey | ZFLBZHXQAMUEFS-PKDNWHCCSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OCC(=O)OC)NC[C@@H](C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)