Products 86618-09-9
CAS 86618-09-9 appears in our catalog under these names: Pranoprofen Impurity 34, Pranoprofen Impurity 29. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoate (CAS 86618-09-9) is a chemical compound with the molecular formula C17H17NO3 and a molecular weight of 283.32 g/mol. IUPAC name: ethyl 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoate. InChIKey: NIAIDINVKZAMSL-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | ethyl 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoate |
| InChIKey | NIAIDINVKZAMSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3 |
Computed by PubChem (NCBI)