Products 866996-52-3
CAS 866996-52-3 appears in our catalog under these names: 5-Hydroxy-2-methyl-4-nitro-benzoic acid methyl ester, 95%, Methyl 5-hydroxy-2-methyl-4-nitrobenzoate 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g.
Methyl 5-hydroxy-2-methyl-4-nitrobenzoate (CAS 866996-52-3) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 5-hydroxy-2-methyl-4-nitrobenzoate. InChIKey: VTUVDQMFXYQGBB-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 5-hydroxy-2-methyl-4-nitrobenzoate |
| InChIKey | VTUVDQMFXYQGBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)