Products 86718-18-5
CAS 86718-18-5 appears in our catalog under these names: 4-Amino-2-ethoxy-5-nitrobenzoic Acid, >95% (HPLC), 4-Amino-2-ethoxy-5-nitrobenzoic acid 98%, 4-AMINO-2-ETHOXY-5-NITROBENZOIC ACID, 98%, 98%, 4-Amino-2-ethoxy-5-nitrobenzoic acid, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-amino-2-ethoxy-5-nitrobenzoic acid (CAS 86718-18-5) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 4-amino-2-ethoxy-5-nitrobenzoic acid. InChIKey: VWEUQGXBVCSDPM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 4-amino-2-ethoxy-5-nitrobenzoic acid |
| InChIKey | VWEUQGXBVCSDPM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)