CAS 868271-15-2 appears in our catalog under these names: 4-Chloro-1,2-benzoxazol-3-amine, 98%, 4-Chloro-1,2-benzoxazol-3-amine, 4-Chlorobenzo[d]isoxazol-3-amine 95%, 4-Chloro-1,2-benzoxazol-3-amine, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 2,5g, 100mg, 250mg.
4-chloro-1,2-benzoxazol-3-amine (CAS 868271-15-2) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 4-chloro-1,2-benzoxazol-3-amine. InChIKey: IHRBIDHQEMTPAK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 4-chloro-1,2-benzoxazol-3-amine |
| InChIKey | IHRBIDHQEMTPAK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NO2)N |
Computed by PubChem (NCBI)