Products 869950-39-0
CAS 869950-39-0 is the registry number for 2-Amino-4-(2,4-dimethyl-phenyl)-thiophene-3-carboxylic acid amide. Offered by: Fluorochem. Available pack sizes: 250mg.
2-amino-4-(2,4-dimethylphenyl)thiophene-3-carboxamide (CAS 869950-39-0) is a chemical compound with the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. IUPAC name: 2-amino-4-(2,4-dimethylphenyl)thiophene-3-carboxamide. InChIKey: GRWBTXZENULKJJ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2OS |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 2-amino-4-(2,4-dimethylphenyl)thiophene-3-carboxamide |
| InChIKey | GRWBTXZENULKJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CSC(=C2C(=O)N)N)C |
Computed by PubChem (NCBI)