Products 869990-49-8
CAS 869990-49-8 appears in our catalog under these names: 4-Fluoro-3-isopropoxybenzoic acid, 97%, 4-Fluoro--3-isopropoxybenzoic acid, 95%, 4-Fluoro-3-isopropoxybenzoic acid, ≥95%, ≥95%, 4-Fluoro-3-isopropoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-fluoro-3-propan-2-yloxybenzoic acid (CAS 869990-49-8) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: 4-fluoro-3-propan-2-yloxybenzoic acid. InChIKey: PHETVLCLIWNJAB-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 4-fluoro-3-propan-2-yloxybenzoic acid |
| InChIKey | PHETVLCLIWNJAB-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)