CAS 870-50-8 appears in our catalog under these names: Di-tert-butyl Azodicarboxylate, >95% (HPLC), Di–tert–butyl azodicarboxylate, Di-tert-butyl azodicarboxylate, 98% , Di-tert-butyl azodicarboxylate, Di-tert-butyl Azodicarboxylate (20% in Toluene). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 100mg, 1g, 5g, 100g, 500g, 25g, 2kg, 1kg.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate (CAS 870-50-8) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate. InChIKey: QKSQWQOAUQFORH-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate |
| InChIKey | QKSQWQOAUQFORH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)