Products 87019-54-3
CAS 87019-54-3 is the registry number for L-Valine-1-13C,15N. Offered by: MedChemExpress. Available pack sizes: 100 mg, 10 mg, 5 mg, 50 mg, 25 mg.
(2S)-2-(15N)azanyl-3-methyl(113C)butanoic acid (CAS 87019-54-3) is a chemical compound with the molecular formula C5H11NO2 and a molecular weight of 119.13 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-methyl(113C)butanoic acid. InChIKey: KZSNJWFQEVHDMF-UGESQCEXSA-N.
| Molecular formula | C5H11NO2 |
|---|---|
| Molecular weight | 119.13 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-methyl(113C)butanoic acid |
| InChIKey | KZSNJWFQEVHDMF-UGESQCEXSA-N |
| SMILES | CC(C)[C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)