Products 870552-47-9
CAS 870552-47-9 appears in our catalog under these names: 4-Bromo-3,3-dimethylindolin-2-one, 98%, 4-Bromo-3,3-dimethylindolin-2-one, 97%, 4–BROMO–3，3–DIMETHYLINDOLIN–2–ONE, 4-bromo-3,3-dimethylindolin-2-one, 4-Bromo-3,3-dimethylindolin-2-one 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 10g, 100mg, 5g, 25g.
4-bromo-3,3-dimethyl-1H-indol-2-one (CAS 870552-47-9) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-bromo-3,3-dimethyl-1H-indol-2-one. InChIKey: JOYAZIZUUBNQFV-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-bromo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | JOYAZIZUUBNQFV-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC=C2Br)NC1=O)C |
Computed by PubChem (NCBI)