CAS 870822-89-2 is the registry number for tert-Butyl (S)-2-(1-(4-(ethoxycarbonyl)phenyl)ethyl)hydrazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-[(1S)-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]ethyl]benzoate (CAS 870822-89-2) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: ethyl 4-[(1S)-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]ethyl]benzoate. InChIKey: UMABWHANJGIRER-NSHDSACASA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | ethyl 4-[(1S)-1-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]ethyl]benzoate |
| InChIKey | UMABWHANJGIRER-NSHDSACASA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)[C@H](C)NNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)