CAS 87120-79-4 appears in our catalog under these names: tert–Butyl 4–(2–nitrobenzylamino)piperidine–1–carboxylate, tert-Butyl 4-(2-nitrobenzylamino)piperidine-1-carboxylate, 95+%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
Tert-butyl 4-[(2-nitrophenyl)methylamino]piperidine-1-carboxylate (CAS 87120-79-4) is a chemical compound with the molecular formula C17H25N3O4 and a molecular weight of 335.4 g/mol. IUPAC name: tert-butyl 4-[(2-nitrophenyl)methylamino]piperidine-1-carboxylate. InChIKey: VKDSQWXGRAQKGY-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | tert-butyl 4-[(2-nitrophenyl)methylamino]piperidine-1-carboxylate |
| InChIKey | VKDSQWXGRAQKGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NCC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)