CAS 871224-68-9 is the registry number for (S)-2-(Methylamino)-2-oxo-1-phenylethyl 4-methylbenzenesulfonate. Offered by: Biosynth. Available pack sizes: 0,25g, 0,5g, 1g, 2g.
[(1S)-2-(methylamino)-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate (CAS 871224-68-9) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: [(1S)-2-(methylamino)-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate. InChIKey: ZXULXMJUEFTWLC-HNNXBMFYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | [(1S)-2-(methylamino)-2-oxo-1-phenylethyl] 4-methylbenzenesulfonate |
| InChIKey | ZXULXMJUEFTWLC-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@@H](C2=CC=CC=C2)C(=O)NC |
Computed by PubChem (NCBI)