Products 871709-84-1
CAS 871709-84-1 appears in our catalog under these names: 3-Amino-1H-indazole-5-carboxylic acid, 96%, 3-Amino-1H-indazole-5-carboxylic acid, 98%, 3–Amino–1H–indazole–5–carboxylic acid, 3-Amino-1H-indazole-5-carboxylic acid, 96%, 96%, 3-Amino-1H-indazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
3-amino-1H-indazole-5-carboxylic acid (CAS 871709-84-1) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 3-amino-1H-indazole-5-carboxylic acid. InChIKey: YEGQMUOUKUEJRM-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 3-amino-1H-indazole-5-carboxylic acid |
| InChIKey | YEGQMUOUKUEJRM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=NN2)N |
Computed by PubChem (NCBI)