Products 87214-68-4

CAS 87214-68-4 is the registry number for tert-Butyl 5-methyl-2-oxo-2,3-dihydro-1H-imidazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate (CAS 87214-68-4) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate. InChIKey: OPOHUNOHANROOK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14N2O3
Molecular weight198.22 g/mol
IUPAC nametert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate
InChIKeyOPOHUNOHANROOK-UHFFFAOYSA-N
SMILESCC1=C(NC(=O)N1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)