CAS 87214-68-4 is the registry number for tert-Butyl 5-methyl-2-oxo-2,3-dihydro-1H-imidazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate (CAS 87214-68-4) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate. InChIKey: OPOHUNOHANROOK-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl 5-methyl-2-oxo-1,3-dihydroimidazole-4-carboxylate |
| InChIKey | OPOHUNOHANROOK-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=O)N1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)