Products 872141-23-6
CAS 872141-23-6 is the registry number for WAY-255348. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(7-fluoro-3,3-dimethyl-2-oxo-1H-indol-5-yl)-1-methylpyrrole-2-carbonitrile (CAS 872141-23-6) is a chemical compound with the molecular formula C16H14FN3O and a molecular weight of 283.30 g/mol. IUPAC name: 5-(7-fluoro-3,3-dimethyl-2-oxo-1H-indol-5-yl)-1-methylpyrrole-2-carbonitrile. InChIKey: KIOOLNRTWPFVHX-UHFFFAOYSA-N.
| Molecular formula | C16H14FN3O |
|---|---|
| Molecular weight | 283.30 g/mol |
| IUPAC name | 5-(7-fluoro-3,3-dimethyl-2-oxo-1H-indol-5-yl)-1-methylpyrrole-2-carbonitrile |
| InChIKey | KIOOLNRTWPFVHX-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC(=C2)C3=CC=C(N3C)C#N)F)NC1=O)C |
Computed by PubChem (NCBI)