Products 872174-18-0
CAS 872174-18-0 is the registry number for (1R,3R)-(Fmoc-amino)cyclopentanecarboxylicacid 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Trans-(1R,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 872174-18-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: trans-(1R,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: BHDMUBZVWRSQOT-ZIAGYGMSSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | trans-(1R,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | BHDMUBZVWRSQOT-ZIAGYGMSSA-N |
| SMILES | C1C[C@H](C[C@@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)