CAS 87234-28-4 appears in our catalog under these names: 1,3-dichloro-2-phenylpropan-2-ol, 95%, 95%, 1,3-DICHLORO-2-HYDROXY-2-PHENYLPROPANE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
1,3-dichloro-2-phenylpropan-2-ol (CAS 87234-28-4) is a chemical compound with the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. IUPAC name: 1,3-dichloro-2-phenylpropan-2-ol. InChIKey: XNWMBCIVHSJEIG-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O |
|---|---|
| Molecular weight | 205.08 g/mol |
| IUPAC name | 1,3-dichloro-2-phenylpropan-2-ol |
| InChIKey | XNWMBCIVHSJEIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCl)(CCl)O |
Computed by PubChem (NCBI)