CAS 873310-31-7 appears in our catalog under these names: Atomoxetine USP related compound C HCl, rac-Atomoxetine EP Impurity C HCl, Atomoxetine Impurity 15, Atomoxetine Impurity 3(Atomoxetine EP Impurity C), p-Methyl Atomoxetine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
N-methyl-3-(4-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride (CAS 873310-31-7) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 291.8 g/mol. IUPAC name: N-methyl-3-(4-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride. InChIKey: JVGQLTAODNXGTO-UHFFFAOYSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 291.8 g/mol |
| IUPAC name | N-methyl-3-(4-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride |
| InChIKey | JVGQLTAODNXGTO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC(CCNC)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)