CAS 874288-02-5 appears in our catalog under these names: 4–(4–Chlorophenylcarbamoyl)phenylboronic acid, 4-(4-Chlorophenylcarbamoyl)phenylboronic acid, 97+%, 97+%, (4-((4-Chlorophenyl)carbamoyl)phenyl)boronic acid, 97%, (4-((4-Chlorophenyl)carbamoyl)phenyl)boronic acid, 97+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
[4-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-02-5) is a chemical compound with the molecular formula C13H11BClNO3 and a molecular weight of 275.50 g/mol. IUPAC name: [4-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: KQGSKPWDDNXYNQ-UHFFFAOYSA-N.
| Molecular formula | C13H11BClNO3 |
|---|---|
| Molecular weight | 275.50 g/mol |
| IUPAC name | [4-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | KQGSKPWDDNXYNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)