Products 874288-31-0

CAS 874288-31-0 is the registry number for 3-(4-Chlorophenylcarbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[3-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-31-0) is a chemical compound with the molecular formula C13H11BClNO3 and a molecular weight of 275.50 g/mol. IUPAC name: [3-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: KBHSCCBYOWTUJD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11BClNO3
Molecular weight275.50 g/mol
IUPAC name[3-[(4-chlorophenyl)carbamoyl]phenyl]boronic acid
InChIKeyKBHSCCBYOWTUJD-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)Cl)(O)O

Computed by PubChem (NCBI)