CAS 874288-04-7 appears in our catalog under these names: 4-(2-Chlorophenylcarbamoyl)phenylboronic acid, 95%, (4-((2-Chlorophenyl)carbamoyl)phenyl)boronic acid, 97%, (4–((2–Chlorophenyl)carbamoyl)phenyl)boronic acid, B-[4-[[(2-Chlorophenyl)amino]carbonyl]phenyl]boronic acid, 95%, 95%, (4-((2-Chlorophenyl)carbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 50mg.
[4-[(2-chlorophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-04-7) is a chemical compound with the molecular formula C13H11BClNO3 and a molecular weight of 275.50 g/mol. IUPAC name: [4-[(2-chlorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: XVMZTRLIHUGIFN-UHFFFAOYSA-N.
| Molecular formula | C13H11BClNO3 |
|---|---|
| Molecular weight | 275.50 g/mol |
| IUPAC name | [4-[(2-chlorophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | XVMZTRLIHUGIFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2Cl)(O)O |
Computed by PubChem (NCBI)