CAS 874289-58-4 appears in our catalog under these names: N-Methoxy 3-borono-4-fluorobenzamide, 98%, N-Methoxy 3-borono-4-fluorobenzamide, ≥95%, ≥95%, (2-Fluoro-5-(methoxycarbamoyl)phenyl)boronic acid, 98%, (2-Fluoro-5-(methoxycarbamoyl)phenyl)boronic acid. Offered by: Combi-blocks, Chemat, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
[2-fluoro-5-(methoxycarbamoyl)phenyl]boronic acid (CAS 874289-58-4) is a chemical compound with the molecular formula C8H9BFNO4 and a molecular weight of 212.97 g/mol. IUPAC name: [2-fluoro-5-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: BICVNGATAFRLPE-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO4 |
|---|---|
| Molecular weight | 212.97 g/mol |
| IUPAC name | [2-fluoro-5-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | BICVNGATAFRLPE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NOC)F)(O)O |
Computed by PubChem (NCBI)