CAS 913835-47-9 appears in our catalog under these names: N-Methoxy 5-borono-2-fluorobenzamide, 98%, (4-Fluoro-3-(methoxycarbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
[4-fluoro-3-(methoxycarbamoyl)phenyl]boronic acid (CAS 913835-47-9) is a chemical compound with the molecular formula C8H9BFNO4 and a molecular weight of 212.97 g/mol. IUPAC name: [4-fluoro-3-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: OJNRHYRWHLOKBF-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO4 |
|---|---|
| Molecular weight | 212.97 g/mol |
| IUPAC name | [4-fluoro-3-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | OJNRHYRWHLOKBF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NOC)(O)O |
Computed by PubChem (NCBI)