CAS 913835-58-2 appears in our catalog under these names: N-Methoxy 4-borono-2-fluorobenzamide, 97%, N-Methoxy 4-borono-2-fluorobenzamide, 98%, 98%, (3-Fluoro-4-(methoxycarbamoyl)phenyl)boronic acid 98%, (3-Fluoro-4-(methoxycarbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[3-fluoro-4-(methoxycarbamoyl)phenyl]boronic acid (CAS 913835-58-2) is a chemical compound with the molecular formula C8H9BFNO4 and a molecular weight of 212.97 g/mol. IUPAC name: [3-fluoro-4-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: RZYYOLUTTNFCAU-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO4 |
|---|---|
| Molecular weight | 212.97 g/mol |
| IUPAC name | [3-fluoro-4-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | RZYYOLUTTNFCAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NOC)F)(O)O |
Computed by PubChem (NCBI)