Products 874518-60-2
CAS 874518-60-2 is the registry number for 4,5-Bis(methoxymethoxy)-2-nitro-benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
4,5-bis(methoxymethoxy)-2-nitrobenzaldehyde (CAS 874518-60-2) is a chemical compound with the molecular formula C11H13NO7 and a molecular weight of 271.22 g/mol. IUPAC name: 4,5-bis(methoxymethoxy)-2-nitrobenzaldehyde. InChIKey: MKKCSMXQWQAGMX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO7 |
|---|---|
| Molecular weight | 271.22 g/mol |
| IUPAC name | 4,5-bis(methoxymethoxy)-2-nitrobenzaldehyde |
| InChIKey | MKKCSMXQWQAGMX-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCOC |
Computed by PubChem (NCBI)