CAS 874518-62-4 appears in our catalog under these names: 3-Acetyl-4-hydroxy-5-methoxybenzoic acid, 98%, Opicapone Impurity 2, Opicapone Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
3-acetyl-4-hydroxy-5-methoxybenzoic acid (CAS 874518-62-4) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 3-acetyl-4-hydroxy-5-methoxybenzoic acid. InChIKey: NYJYLNNACNCISZ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 3-acetyl-4-hydroxy-5-methoxybenzoic acid |
| InChIKey | NYJYLNNACNCISZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)C(=O)O)OC)O |
Computed by PubChem (NCBI)