CAS 874786-49-9 is the registry number for Isopropyl 4-Chloropicolinate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g.
Propan-2-yl 4-chloropyridine-2-carboxylate (CAS 874786-49-9) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: propan-2-yl 4-chloropyridine-2-carboxylate. InChIKey: LJUOXGAAXHSWEP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | propan-2-yl 4-chloropyridine-2-carboxylate |
| InChIKey | LJUOXGAAXHSWEP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)