CAS 875164-21-9 is the registry number for 4-(3-Phenyl-1,2,4-oxadiazol-5-yl)butanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoic acid (CAS 875164-21-9) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoic acid. InChIKey: MZTVBDKRHBBHNR-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)butanoic acid |
| InChIKey | MZTVBDKRHBBHNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CCCC(=O)O |
Computed by PubChem (NCBI)