CAS 87524-66-1 appears in our catalog under these names: 4-(2-Methoxy-2-oxoethyl)benzoic acid, 98%, 4–(2–Methoxy–2–oxoethyl)benzoic acid, 4-(2-methoxy-2-oxoethyl)benzoic acid, 4-(2-Methoxy-2-oxoethyl)benzoic acid, 95%, 95%, 4-(2-Methoxy-2-oxoethyl)benzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg, 500mg, 100g.
4-(2-methoxy-2-oxoethyl)benzoic acid (CAS 87524-66-1) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-(2-methoxy-2-oxoethyl)benzoic acid. InChIKey: LUFHLJPQDOKZKU-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-(2-methoxy-2-oxoethyl)benzoic acid |
| InChIKey | LUFHLJPQDOKZKU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)