Products 875252-65-6

CAS 875252-65-6 is the registry number for Prilocaine EP Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

N-(3-methylphenyl)-2-(propylamino)propanamide (CAS 875252-65-6) is a chemical compound with the molecular formula C13H20N2O and a molecular weight of 220.31 g/mol. IUPAC name: N-(3-methylphenyl)-2-(propylamino)propanamide. InChIKey: HPKDESQTIVNIJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O
Molecular weight220.31 g/mol
IUPAC nameN-(3-methylphenyl)-2-(propylamino)propanamide
InChIKeyHPKDESQTIVNIJZ-UHFFFAOYSA-N
SMILESCCCNC(C)C(=O)NC1=CC=CC(=C1)C

Computed by PubChem (NCBI)