CAS 87544-86-3 appears in our catalog under these names: Topiroxostat Impurity 56, Topiroxostat Impurity 15. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 3-carbamoylpyridine-4-carboxylate (CAS 87544-86-3) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: methyl 3-carbamoylpyridine-4-carboxylate. InChIKey: WCNOFJUBVQZHNZ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | methyl 3-carbamoylpyridine-4-carboxylate |
| InChIKey | WCNOFJUBVQZHNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)C(=O)N |
Computed by PubChem (NCBI)