CAS 875898-89-8 is the registry number for 1,1-Dimethylethyl N-[(1S,3S)-3-cyanocyclopentyl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(1S,3S)-3-cyanocyclopentyl]carbamate (CAS 875898-89-8) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl N-[(1S,3S)-3-cyanocyclopentyl]carbamate. InChIKey: LHUKLMWDVACRKQ-IUCAKERBSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl N-[(1S,3S)-3-cyanocyclopentyl]carbamate |
| InChIKey | LHUKLMWDVACRKQ-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C1)C#N |
Computed by PubChem (NCBI)