CAS 875902-97-9 is the registry number for 2,4–dimethoxyisophthalaldehyde. Offered by: GLPBio. Available pack sizes: 200mg.
2,4-dimethoxybenzene-1,3-dicarbaldehyde (CAS 875902-97-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2,4-dimethoxybenzene-1,3-dicarbaldehyde. InChIKey: IFEHNGDBFMBCQW-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2,4-dimethoxybenzene-1,3-dicarbaldehyde |
| InChIKey | IFEHNGDBFMBCQW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)OC)C=O |
Computed by PubChem (NCBI)