Products 876379-78-1
CAS 876379-78-1 is the registry number for 3-Chloropyrazolo[1,5-a]pyridine-2-carboxylic acid, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
3-chloropyrazolo[1,5-a]pyridine-2-carboxylic acid (CAS 876379-78-1) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 3-chloropyrazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: JTAMIZKWJZERBS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 3-chloropyrazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | JTAMIZKWJZERBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NN2C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)