CAS 876728-37-9 is the registry number for 3-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.
3-(1,2,4-triazol-1-ylmethyl)benzonitrile (CAS 876728-37-9) is a chemical compound with the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. IUPAC name: 3-(1,2,4-triazol-1-ylmethyl)benzonitrile. InChIKey: ZYQNZNVPCHZDLT-UHFFFAOYSA-N.
| Molecular formula | C10H8N4 |
|---|---|
| Molecular weight | 184.20 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-ylmethyl)benzonitrile |
| InChIKey | ZYQNZNVPCHZDLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CN2C=NC=N2 |
Computed by PubChem (NCBI)