CAS 876734-22-4 is the registry number for 1-(4-Methoxyphenyl)-1H-indole-3-carbonitrile, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-(4-methoxyphenyl)indole-3-carbonitrile (CAS 876734-22-4) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1-(4-methoxyphenyl)indole-3-carbonitrile. InChIKey: UUTBJIWPHZEART-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)indole-3-carbonitrile |
| InChIKey | UUTBJIWPHZEART-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C=C(C3=CC=CC=C32)C#N |
Computed by PubChem (NCBI)