CAS 87736-88-7 appears in our catalog under these names: 4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)benzyl Alcohol, (4–(3–(Trifluoromethyl)–3H–diazirin–3–yl)phenyl)methanol, 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Alcohol, >97.0%(HPLC), 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Alcohol, 97%, 97%, (4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)phenyl)methanol, 96%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 200mg, 500mg, 5g.
[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol (CAS 87736-88-7) is a chemical compound with the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. IUPAC name: [4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol. InChIKey: UZHHTEASLDJYBO-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2O |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methanol |
| InChIKey | UZHHTEASLDJYBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)