Products 87808-44-4

CAS 87808-44-4 appears in our catalog under these names: 3-Methoxy-4-methylbenzoyl chloride, 95+%, 3-methoxy-4-methylbenzoyl chloride, ≥95%, ≥95%, 3-Methoxy-4-methyl-benzoyl chloride, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g.

3-methoxy-4-methylbenzoyl chloride (CAS 87808-44-4) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 3-methoxy-4-methylbenzoyl chloride. InChIKey: BQJLTBKKFLTXKO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO2
Molecular weight184.62 g/mol
IUPAC name3-methoxy-4-methylbenzoyl chloride
InChIKeyBQJLTBKKFLTXKO-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)Cl)OC

Computed by PubChem (NCBI)