CAS 87808-44-4 appears in our catalog under these names: 3-Methoxy-4-methylbenzoyl chloride, 95+%, 3-methoxy-4-methylbenzoyl chloride, ≥95%, ≥95%, 3-Methoxy-4-methyl-benzoyl chloride, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g.
3-methoxy-4-methylbenzoyl chloride (CAS 87808-44-4) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 3-methoxy-4-methylbenzoyl chloride. InChIKey: BQJLTBKKFLTXKO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 3-methoxy-4-methylbenzoyl chloride |
| InChIKey | BQJLTBKKFLTXKO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)Cl)OC |
Computed by PubChem (NCBI)