Products 878770-54-8
CAS 878770-54-8 is the registry number for 4-(1H-Benzoimidazol-2-yl)-phenol hydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4-(1H-benzimidazol-2-yl)phenol;hydrochloride (CAS 878770-54-8) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)phenol;hydrochloride. InChIKey: UCLLECODCWOJTA-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)phenol;hydrochloride |
| InChIKey | UCLLECODCWOJTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)O.Cl |
Computed by PubChem (NCBI)