CAS 879361-74-7 is the registry number for 2-Chloro-N-methyl-N-((3-methylthiophen-2-yl)methyl)acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]acetamide (CAS 879361-74-7) is a chemical compound with the molecular formula C9H12ClNOS and a molecular weight of 217.72 g/mol. IUPAC name: 2-chloro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]acetamide. InChIKey: HOKKZQIVVHJFIS-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNOS |
|---|---|
| Molecular weight | 217.72 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| InChIKey | HOKKZQIVVHJFIS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)CN(C)C(=O)CCl |
Computed by PubChem (NCBI)