CAS 88-22-2 appears in our catalog under these names: 2-Amino-3,5-dimethylbenzenesulfonic acid 98%, 2-Amino-3,5-dimethylbenzenesulfonic Acid, >97.0%(HPLC)(T), 2,4-Dimethylaniline-6-sulfonic acid, 97%, 2,4–Dimethylaniline–6–sulfonic acid. Offered by: Ambeed, TCI, Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 100g, 500g, 1g.
2-amino-3,5-dimethylbenzenesulfonic acid (CAS 88-22-2) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-amino-3,5-dimethylbenzenesulfonic acid. InChIKey: CFCXQQUQLZIZPI-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-amino-3,5-dimethylbenzenesulfonic acid |
| InChIKey | CFCXQQUQLZIZPI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)O)N)C |
Computed by PubChem (NCBI)